C13H16F3NO3 — CID 63101993
propyl 2-amino-3-methyl-4-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 63101993) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is propyl 2-amino-3-methyl-4-(2,2,2-trifluoroethoxy)benzoate.
| Compound Name | propyl 2-amino-3-methyl-4-(2,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 63101993 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | propyl 2-amino-3-methyl-4-(2,2,2-trifluoroethoxy)benzoate |
| SMILES | CCCOC(=O)c1ccc(OCC(F)(F)F)c(C)c1N |
| InChI | InChI=1S/C13H16F3NO3/c1-3-6-19-12(18)9-4-5-10(8(2)11(9)17)20-7-13(14,15)16/h4-5H,3,6-7,17H2,1-2H3 |
| InChIKey | TYIJGGQRIWWYQJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|