C10H10F3NO3 — CID 78929466
propyl 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate (PubChem CID 78929466) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is propyl 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate.
| Compound Name | propyl 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 78929466 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | propyl 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylate |
| SMILES | CCCOC(=O)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C10H10F3NO3/c1-2-5-17-9(16)6-3-4-7(10(11,12)13)14-8(6)15/h3-4H,2,5H2,1H3,(H,14,15) |
| InChIKey | JSLYOBTXLRLNIO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |