C13H13N5O2 — CID 63102295
4-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)-1H-pyrazole-5-carboxamide (PubChem CID 63102295) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63102295 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)-1H-pyrazole-5-carboxamide |
| SMILES | CCc1nc2cc(NC(=O)c3[nH]ncc3N)ccc2o1 |
| InChI | InChI=1S/C13H13N5O2/c1-2-11-17-9-5-7(3-4-10(9)20-11)16-13(19)12-8(14)6-15-18-12/h3-6H,2,14H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | YZTPTBSLTUESHK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |