C12H10IN3O4 — CID 63111270
5-iodo-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]benzoic acid (PubChem CID 63111270) has the molecular formula C12H10IN3O4 and a molecular weight of 387.13 g/mol. Its IUPAC name is 5-iodo-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]benzoic acid.
| Compound Name | 5-iodo-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 63111270 |
| Molecular Formula | C12H10IN3O4 |
| Molecular Weight | 387.13 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 5-iodo-2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]benzoic acid |
| SMILES | O=C1CCC(C(=O)Nc2ccc(I)cc2C(=O)O)=NN1 |
| InChI | InChI=1S/C12H10IN3O4/c13-6-1-2-8(7(5-6)12(19)20)14-11(18)9-3-4-10(17)16-15-9/h1-2,5H,3-4H2,(H,14,18)(H,16,17)(H,19,20) |
| InChIKey | SXVWWGOLHGIHNA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|