C13H11N4O3+ — CID 6312848
(E)-2-cyano-3-[3-(4-methylphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]prop-2-enamide (PubChem CID 6312848) has the molecular formula C13H11N4O3+ and a molecular weight of 271.26 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-(4-methylphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-(4-methylphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6312848 |
| Molecular Formula | C13H11N4O3+ |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (E)-2-cyano-3-[3-(4-methylphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]prop-2-enamide |
| SMILES | Cc1ccc(-[n+]2[nH]oc(=O)c2/C=C(\C#N)C(N)=O)cc1 |
| InChI | InChI=1S/C13H10N4O3/c1-8-2-4-10(5-3-8)17-11(13(19)20-16-17)6-9(7-14)12(15)18/h2-6H,1H3,(H2-,15,16,18,19)/p+1 |
| InChIKey | NPKOGYWLTNWPOK-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|