methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate

C10H18O5S — CID 63166218

IUPACmethyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate
SMILESCOC(=O)C(C(C)C)C1(O)CCS(=O)(=O)C1
InChIInChI=1S/C10H18O5S/c1-7(2)8(9(11)15-3)10(12)4-5-16(13,14)6-10/h7-8,12H,4-6H2,1-3H3
InChIKeyXBEIPFUZZYYENE-UHFFFAOYSA-N
MW250.32 g/mol
LogP-0.02
Rot. Bonds3

About methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate

methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate (PubChem CID 63166218) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate.

Molecular Properties

Compound Namemethyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate
PubChem CID63166218
Molecular FormulaC10H18O5S
Molecular Weight250.32 g/mol
Exact Mass250.09
IUPAC Namemethyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate
SMILESCOC(=O)C(C(C)C)C1(O)CCS(=O)(=O)C1
InChIInChI=1S/C10H18O5S/c1-7(2)8(9(11)15-3)10(12)4-5-16(13,14)6-10/h7-8,12H,4-6H2,1-3H3
InChIKeyXBEIPFUZZYYENE-UHFFFAOYSA-N
XLogP-0.02
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.32
LogP ≤ 5-0.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate?
The IUPAC name of methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate (CID 63166218) is methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate.
What is the SMILES notation for methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate?
The canonical SMILES for methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate is COC(=O)C(C(C)C)C1(O)CCS(=O)(=O)C1.
What is the InChIKey of methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate?
The InChIKey is XBEIPFUZZYYENE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5S/c1-7(2)8(9(11)15-3)10(12)4-5-16(13,14)6-10/h7-8,12H,4-6H2,1-3H3.
What are the key properties of methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate?
methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate has a molecular weight of 250.32 g/mol, XLogP of -0.02, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoate is sourced from PubChem (CID 63166218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).