C27H30N4O2S2 — CID 6316642
6-(4-benzylpiperidin-1-yl)-4-methyl-5-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-1-propylpyridine-3-carbonitrile (PubChem CID 6316642) has the molecular formula C27H30N4O2S2 and a molecular weight of 506.70 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-4-methyl-5-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-1-propylpyridine-3-carbonitrile.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-4-methyl-5-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6316642 |
| Molecular Formula | C27H30N4O2S2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-4-methyl-5-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-1-propylpyridine-3-carbonitrile |
| SMILES | CCCn1c(N2CCC(Cc3ccccc3)CC2)c(/C=C2\SC(=S)N(C)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C27H30N4O2S2/c1-4-12-31-24(30-13-10-20(11-14-30)15-19-8-6-5-7-9-19)21(18(2)22(17-28)25(31)32)16-23-26(33)29(3)27(34)35-23/h5-9,16,20H,4,10-15H2,1-3H3/b23-16- |
| InChIKey | VLJCCMXKZNKWHC-KQWNVCNZSA-N |
| XLogP | 4.73 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|