C12H20N2O — CID 63177351
N'-[4-(furan-2-yl)butan-2-yl]butanimidamide (PubChem CID 63177351) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N'-[4-(furan-2-yl)butan-2-yl]butanimidamide.
| Compound Name | N'-[4-(furan-2-yl)butan-2-yl]butanimidamide |
|---|---|
| PubChem CID | 63177351 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N'-[4-(furan-2-yl)butan-2-yl]butanimidamide |
| SMILES | CCC/C(N)=N\C(C)CCc1ccco1 |
| InChI | InChI=1S/C12H20N2O/c1-3-5-12(13)14-10(2)7-8-11-6-4-9-15-11/h4,6,9-10H,3,5,7-8H2,1-2H3,(H2,13,14) |
| InChIKey | CQHFZJNZTCKEGD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 51.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|