C10H15N3OS — CID 63179484
2-(4-methyl-1,3-thiazol-2-yl)-1-morpholin-4-ylethanimine (PubChem CID 63179484) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-1-morpholin-4-ylethanimine.
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-1-morpholin-4-ylethanimine |
|---|---|
| PubChem CID | 63179484 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-1-morpholin-4-ylethanimine |
| SMILES | [H]/N=C(/Cc1nc(C)cs1)N1CCOCC1 |
| InChI | InChI=1S/C10H15N3OS/c1-8-7-15-10(12-8)6-9(11)13-2-4-14-5-3-13/h7,11H,2-6H2,1H3/b11-9- |
| InChIKey | OHAKFQXIZDLDRY-LUAWRHEFSA-N |
| XLogP | 1.30 |
| TPSA | 49.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|