C12H17F3N4OS — CID 120661766
2-methyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]morpholine-4-carboximidamide (PubChem CID 120661766) has the molecular formula C12H17F3N4OS and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-methyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]morpholine-4-carboximidamide.
| Compound Name | 2-methyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 120661766 |
| Molecular Formula | C12H17F3N4OS |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-methyl-N'-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]morpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/CCc2nc(C(F)(F)F)cs2)CCO1 |
| InChI | InChI=1S/C12H17F3N4OS/c1-8-6-19(4-5-20-8)11(16)17-3-2-10-18-9(7-21-10)12(13,14)15/h7-8H,2-6H2,1H3,(H2,16,17) |
| InChIKey | BYXAYLSCQUYRRB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|