C13H20Cl2N2 — CID 63202230
1-(3,5-dichloro-2-pyridinyl)-3-methyl-N-propylbutan-2-amine (PubChem CID 63202230) has the molecular formula C13H20Cl2N2 and a molecular weight of 275.22 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-3-methyl-N-propylbutan-2-amine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-3-methyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 63202230 |
| Molecular Formula | C13H20Cl2N2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-3-methyl-N-propylbutan-2-amine |
| SMILES | CCCNC(Cc1ncc(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C13H20Cl2N2/c1-4-5-16-12(9(2)3)7-13-11(15)6-10(14)8-17-13/h6,8-9,12,16H,4-5,7H2,1-3H3 |
| InChIKey | FXYZYVPZBGGFJV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |