C12H15ClN2S — CID 63202692
4-(2-chloro-3,3-dimethylbutyl)thieno[2,3-d]pyrimidine (PubChem CID 63202692) has the molecular formula C12H15ClN2S and a molecular weight of 254.79 g/mol. Its IUPAC name is 4-(2-chloro-3,3-dimethylbutyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-(2-chloro-3,3-dimethylbutyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 63202692 |
| Molecular Formula | C12H15ClN2S |
| Molecular Weight | 254.79 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 4-(2-chloro-3,3-dimethylbutyl)thieno[2,3-d]pyrimidine |
| SMILES | CC(C)(C)C(Cl)Cc1ncnc2sccc12 |
| InChI | InChI=1S/C12H15ClN2S/c1-12(2,3)10(13)6-9-8-4-5-16-11(8)15-7-14-9/h4-5,7,10H,6H2,1-3H3 |
| InChIKey | RPABIFMTAMUSSX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|