C11H13N3S — CID 63352857
1-cyclopropyl-2-thieno[2,3-d]pyrimidin-4-ylethanamine (PubChem CID 63352857) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-cyclopropyl-2-thieno[2,3-d]pyrimidin-4-ylethanamine.
| Compound Name | 1-cyclopropyl-2-thieno[2,3-d]pyrimidin-4-ylethanamine |
|---|---|
| PubChem CID | 63352857 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 1-cyclopropyl-2-thieno[2,3-d]pyrimidin-4-ylethanamine |
| SMILES | NC(Cc1ncnc2sccc12)C1CC1 |
| InChI | InChI=1S/C11H13N3S/c12-9(7-1-2-7)5-10-8-3-4-15-11(8)14-6-13-10/h3-4,6-7,9H,1-2,5,12H2 |
| InChIKey | BEQFPSBWTQUPJS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |