C10H13N3S — CID 63197779
1-thieno[2,3-d]pyrimidin-4-ylbutan-2-amine (PubChem CID 63197779) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 1-thieno[2,3-d]pyrimidin-4-ylbutan-2-amine.
| Compound Name | 1-thieno[2,3-d]pyrimidin-4-ylbutan-2-amine |
|---|---|
| PubChem CID | 63197779 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-thieno[2,3-d]pyrimidin-4-ylbutan-2-amine |
| SMILES | CCC(N)Cc1ncnc2sccc12 |
| InChI | InChI=1S/C10H13N3S/c1-2-7(11)5-9-8-3-4-14-10(8)13-6-12-9/h3-4,6-7H,2,5,11H2,1H3 |
| InChIKey | RFJIJFJHMVZVDJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |