C10H11N7O2S — CID 63221538
3-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 63221538) has the molecular formula C10H11N7O2S and a molecular weight of 293.31 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 63221538 |
| Molecular Formula | C10H11N7O2S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1ncc2c(NN)nc(CN3C(=O)CSC3=O)nc21 |
| InChI | InChI=1S/C10H11N7O2S/c1-16-9-5(2-12-16)8(15-11)13-6(14-9)3-17-7(18)4-20-10(17)19/h2H,3-4,11H2,1H3,(H,13,14,15) |
| InChIKey | KWVAWJNWPJIBGQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|