C10H11N9O2 — CID 63221765
[1-methyl-6-[(4-nitroimidazol-1-yl)methyl]pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 63221765) has the molecular formula C10H11N9O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is [1-methyl-6-[(4-nitroimidazol-1-yl)methyl]pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [1-methyl-6-[(4-nitroimidazol-1-yl)methyl]pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63221765 |
| Molecular Formula | C10H11N9O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [1-methyl-6-[(4-nitroimidazol-1-yl)methyl]pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cn1ncc2c(NN)nc(Cn3cnc([N+](=O)[O-])c3)nc21 |
| InChI | InChI=1S/C10H11N9O2/c1-17-10-6(2-13-17)9(16-11)14-7(15-10)3-18-4-8(12-5-18)19(20)21/h2,4-5H,3,11H2,1H3,(H,14,15,16) |
| InChIKey | UZYSZXPZOQIPEA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|