C11H21N3O2S — CID 63224737
N-(1-cyanopropan-2-yl)-N,4-dimethylpiperidine-1-sulfonamide (PubChem CID 63224737) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-N,4-dimethylpiperidine-1-sulfonamide.
| Compound Name | N-(1-cyanopropan-2-yl)-N,4-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 63224737 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-N,4-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)N(C)C(C)CC#N)CC1 |
| InChI | InChI=1S/C11H21N3O2S/c1-10-5-8-14(9-6-10)17(15,16)13(3)11(2)4-7-12/h10-11H,4-6,8-9H2,1-3H3 |
| InChIKey | RQCMOPFELIFMEL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |