C13H15FN2 — CID 63232558
3-ethyl-7-fluoro-N,8-dimethylquinolin-2-amine (PubChem CID 63232558) has the molecular formula C13H15FN2 and a molecular weight of 218.27 g/mol. Its IUPAC name is 3-ethyl-7-fluoro-N,8-dimethylquinolin-2-amine.
| Compound Name | 3-ethyl-7-fluoro-N,8-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 63232558 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-ethyl-7-fluoro-N,8-dimethylquinolin-2-amine |
| SMILES | CCc1cc2ccc(F)c(C)c2nc1NC |
| InChI | InChI=1S/C13H15FN2/c1-4-9-7-10-5-6-11(14)8(2)12(10)16-13(9)15-3/h5-7H,4H2,1-3H3,(H,15,16) |
| InChIKey | SUAYIXCKHSPGDD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |