C13H12N4 — CID 63232745
(3-methyl-1,10-phenanthrolin-2-yl)hydrazine (PubChem CID 63232745) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is (3-methyl-1,10-phenanthrolin-2-yl)hydrazine.
| Compound Name | (3-methyl-1,10-phenanthrolin-2-yl)hydrazine |
|---|---|
| PubChem CID | 63232745 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (3-methyl-1,10-phenanthrolin-2-yl)hydrazine |
| SMILES | Cc1cc2ccc3cccnc3c2nc1NN |
| InChI | InChI=1S/C13H12N4/c1-8-7-10-5-4-9-3-2-6-15-11(9)12(10)16-13(8)17-14/h2-7H,14H2,1H3,(H,16,17) |
| InChIKey | YJECHKPFORPARN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|