C36H86O11Si8 — CID 632356
2,3,4,5-tetrakis(trimethylsilyloxy)-6-[3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexanal (PubChem CID 632356) has the molecular formula C36H86O11Si8 and a molecular weight of 919.76 g/mol. Its IUPAC name is 2,3,4,5-tetrakis(trimethylsilyloxy)-6-[3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexanal.
| Compound Name | 2,3,4,5-tetrakis(trimethylsilyloxy)-6-[3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexanal |
|---|---|
| PubChem CID | 632356 |
| Molecular Formula | C36H86O11Si8 |
| Molecular Weight | 919.76 g/mol |
| Exact Mass | 918.43 |
| IUPAC Name | 2,3,4,5-tetrakis(trimethylsilyloxy)-6-[3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexanal |
| SMILES | C[Si](C)(C)OCC1OC(OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C36H86O11Si8/c1-48(2,3)39-27-29-32(44-52(13,14)15)34(46-54(19,20)21)35(47-55(22,23)24)36(40-29)38-26-30(42-50(7,8)9)33(45-53(16,17)18)31(43-51(10,11)12)28(25-37)41-49(4,5)6/h25,28-36H,26-27H2,1-24H3 |
| InChIKey | IPOAJTXLHBAGHK-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.76 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|