About Silane, 1-naphthalenyl-
Silane, 1-naphthalenyl- (PubChem CID 6327533) has the molecular formula C10H7Si
and a molecular weight of 155.25 g/mol.
Molecular Properties
| Compound Name | Silane, 1-naphthalenyl- |
| PubChem CID | 6327533 |
| Molecular Formula | C10H7Si |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | — |
| SMILES | [Si]c1cccc2ccccc12 |
| InChI | InChI=1S/C10H7Si/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | FWTICCZNRCBKOS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silane, 1-naphthalenyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silane, 1-naphthalenyl-?
The IUPAC name of Silane, 1-naphthalenyl- (CID 6327533) is not available.
What is the SMILES notation for Silane, 1-naphthalenyl-?
The canonical SMILES for Silane, 1-naphthalenyl- is [Si]c1cccc2ccccc12.
What is the InChIKey of Silane, 1-naphthalenyl-?
The InChIKey is FWTICCZNRCBKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Si/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H.
What are the key properties of Silane, 1-naphthalenyl-?
Silane, 1-naphthalenyl- has a molecular weight of 155.25 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Silane, 1-naphthalenyl- is sourced from PubChem (CID 6327533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).