C10H21BClSi — CID 6329070
2-Pentene, 3-diethylboryl-2-(chloromethylsilyl)- (PubChem CID 6329070) has the molecular formula C10H21BClSi and a molecular weight of 215.63 g/mol.
| Compound Name | 2-Pentene, 3-diethylboryl-2-(chloromethylsilyl)- |
|---|---|
| PubChem CID | 6329070 |
| Molecular Formula | C10H21BClSi |
| Molecular Weight | 215.63 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | — |
| SMILES | CCB(CC)/C(CC)=C(\C)[Si](C)Cl |
| InChI | InChI=1S/C10H21BClSi/c1-6-10(9(4)13(5)12)11(7-2)8-3/h6-8H2,1-5H3/b10-9+ |
| InChIKey | YNYORCYHTXMGIV-MDZDMXLPSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|