C13H24BSi — CID 6329565
2-Pentene, 3-diethylboryl-2-(methyl-1-propynylsilyl)- (PubChem CID 6329565) has the molecular formula C13H24BSi and a molecular weight of 219.23 g/mol.
| Compound Name | 2-Pentene, 3-diethylboryl-2-(methyl-1-propynylsilyl)- |
|---|---|
| PubChem CID | 6329565 |
| Molecular Formula | C13H24BSi |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | — |
| SMILES | CC#C[Si](C)/C(C)=C(\CC)B(CC)CC |
| InChI | InChI=1S/C13H24BSi/c1-7-11-15(6)12(5)13(8-2)14(9-3)10-4/h8-10H2,1-6H3/b13-12+ |
| InChIKey | OVFFTFVMXVIKFT-OUKQBFOZSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|