About Dicyclohexylmethylsilane
Dicyclohexylmethylsilane (PubChem CID 6329225) has the molecular formula C13H25Si
and a molecular weight of 209.43 g/mol.
Molecular Properties
| Compound Name | Dicyclohexylmethylsilane |
| PubChem CID | 6329225 |
| Molecular Formula | C13H25Si |
| Molecular Weight | 209.43 g/mol |
| Exact Mass | 209.17 |
| IUPAC Name | — |
| SMILES | C[Si](C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H25Si/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h12-13H,2-11H2,1H3 |
| InChIKey | IFIGBRGDQHBFHJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Dicyclohexylmethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dicyclohexylmethylsilane?
The IUPAC name of Dicyclohexylmethylsilane (CID 6329225) is not available.
What is the SMILES notation for Dicyclohexylmethylsilane?
The canonical SMILES for Dicyclohexylmethylsilane is C[Si](C1CCCCC1)C1CCCCC1.
What is the InChIKey of Dicyclohexylmethylsilane?
The InChIKey is IFIGBRGDQHBFHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25Si/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h12-13H,2-11H2,1H3.
What are the key properties of Dicyclohexylmethylsilane?
Dicyclohexylmethylsilane has a molecular weight of 209.43 g/mol, XLogP of 4.78, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Dicyclohexylmethylsilane is sourced from PubChem (CID 6329225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).