C22H28N4NiO2+2 — CID 6332858
bis((6Z)-6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);nickel(2+) (PubChem CID 6332858) has the molecular formula C22H28N4NiO2+2 and a molecular weight of 439.19 g/mol. Its IUPAC name is bis((6Z)-6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);nickel(2+).
| Compound Name | bis((6Z)-6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);nickel(2+) |
|---|---|
| PubChem CID | 6332858 |
| Molecular Formula | C22H28N4NiO2+2 |
| Molecular Weight | 439.19 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | bis((6Z)-6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);nickel(2+) |
| SMILES | O=C1C=CC=C/C1=C/NCCN1CC1.O=C1C=CC=C/C1=C/NCCN1CC1.[Ni+2] |
| InChI | InChI=1S/2C11H14N2O.Ni/c2*14-11-4-2-1-3-10(11)9-12-5-6-13-7-8-13;/h2*1-4,9,12H,5-8H2;/q;;+2/b2*10-9-; |
| InChIKey | JWXQAHSLAHFXRH-CVBJKYQLSA-N |
| XLogP | 0.94 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|