C9H7Cl2N3 — CID 63385020
3-chloro-4-(3-chloro-4-methylphenyl)-1,2,4-triazole (PubChem CID 63385020) has the molecular formula C9H7Cl2N3 and a molecular weight of 228.08 g/mol. Its IUPAC name is 3-chloro-4-(3-chloro-4-methylphenyl)-1,2,4-triazole.
| Compound Name | 3-chloro-4-(3-chloro-4-methylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 63385020 |
| Molecular Formula | C9H7Cl2N3 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 3-chloro-4-(3-chloro-4-methylphenyl)-1,2,4-triazole |
| SMILES | Cc1ccc(-n2cnnc2Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl2N3/c1-6-2-3-7(4-8(6)10)14-5-12-13-9(14)11/h2-5H,1H3 |
| InChIKey | GCQMGPNQRVZXJO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |