C9H6F3N3 — CID 46901293
4-[4-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 46901293) has the molecular formula C9H6F3N3 and a molecular weight of 213.16 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 4-[4-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 46901293 |
| Molecular Formula | C9H6F3N3 |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 4-[4-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | FC(F)(F)c1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C9H6F3N3/c10-9(11,12)7-1-3-8(4-2-7)15-5-13-14-6-15/h1-6H |
| InChIKey | YYTCUGGFOGWRTJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |