C15H24N3+ — CID 6338961
[amino-[(2R)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]methylidene]-diethylazanium (PubChem CID 6338961) has the molecular formula C15H24N3+ and a molecular weight of 246.38 g/mol. Its IUPAC name is [amino-[(2R)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]methylidene]-diethylazanium.
| Compound Name | [amino-[(2R)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]methylidene]-diethylazanium |
|---|---|
| PubChem CID | 6338961 |
| Molecular Formula | C15H24N3+ |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | [amino-[(2R)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]methylidene]-diethylazanium |
| SMILES | CC[N+](CC)=C(N)N1c2ccccc2CC[C@H]1C |
| InChI | InChI=1S/C15H23N3/c1-4-17(5-2)15(16)18-12(3)10-11-13-8-6-7-9-14(13)18/h6-9,12,16H,4-5,10-11H2,1-3H3/p+1/t12-/m1/s1 |
| InChIKey | UNMCBCZIHXWFEM-GFCCVEGCSA-O |
| XLogP | 2.19 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|