C18H21Cl2N — CID 63418391
2,5-dichloro-N-(1-phenylhexyl)aniline (PubChem CID 63418391) has the molecular formula C18H21Cl2N and a molecular weight of 322.28 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-phenylhexyl)aniline.
| Compound Name | 2,5-dichloro-N-(1-phenylhexyl)aniline |
|---|---|
| PubChem CID | 63418391 |
| Molecular Formula | C18H21Cl2N |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2,5-dichloro-N-(1-phenylhexyl)aniline |
| SMILES | CCCCCC(Nc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H21Cl2N/c1-2-3-5-10-17(14-8-6-4-7-9-14)21-18-13-15(19)11-12-16(18)20/h4,6-9,11-13,17,21H,2-3,5,10H2,1H3 |
| InChIKey | IOSYMUHBXJSRMY-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|