C19H24N5S+ — CID 6343099
1-[amino-(4-benzylpiperazin-1-ium-1-ylidene)methyl]-3-phenylthiourea (PubChem CID 6343099) has the molecular formula C19H24N5S+ and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-[amino-(4-benzylpiperazin-1-ium-1-ylidene)methyl]-3-phenylthiourea.
| Compound Name | 1-[amino-(4-benzylpiperazin-1-ium-1-ylidene)methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 6343099 |
| Molecular Formula | C19H24N5S+ |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[amino-(4-benzylpiperazin-1-ium-1-ylidene)methyl]-3-phenylthiourea |
| SMILES | NC(NC(=S)Nc1ccccc1)=[N+]1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H23N5S/c20-18(22-19(25)21-17-9-5-2-6-10-17)24-13-11-23(12-14-24)15-16-7-3-1-4-8-16/h1-10H,11-15H2,(H3,20,21,22,25)/p+1 |
| InChIKey | PZXUTGKIRFMUQK-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|