C18H19BrCl2 — CID 63445108
4-(1-bromo-3-methyl-2-phenylpentyl)-1,2-dichlorobenzene (PubChem CID 63445108) has the molecular formula C18H19BrCl2 and a molecular weight of 386.16 g/mol. Its IUPAC name is 4-(1-bromo-3-methyl-2-phenylpentyl)-1,2-dichlorobenzene.
| Compound Name | 4-(1-bromo-3-methyl-2-phenylpentyl)-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 63445108 |
| Molecular Formula | C18H19BrCl2 |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 4-(1-bromo-3-methyl-2-phenylpentyl)-1,2-dichlorobenzene |
| SMILES | CCC(C)C(c1ccccc1)C(Br)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H19BrCl2/c1-3-12(2)17(13-7-5-4-6-8-13)18(19)14-9-10-15(20)16(21)11-14/h4-12,17-18H,3H2,1-2H3 |
| InChIKey | MUVLOZLIGPSHCI-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|