6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid

C15H14ClNO2 — CID 63462975

IUPAC6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid
SMILESCC1CCc2nc3cc(Cl)ccc3c(C(=O)O)c2C1
InChIInChI=1S/C15H14ClNO2/c1-8-2-5-12-11(6-8)14(15(18)19)10-4-3-9(16)7-13(10)17-12/h3-4,7-8H,2,5-6H2,1H3,(H,18,19)
InChIKeyJVTDIHFKJXLYGX-UHFFFAOYSA-N
MW275.74 g/mol
LogP3.71
Rot. Bonds1

About 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid

6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid (PubChem CID 63462975) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid.

Molecular Properties

Compound Name6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid
PubChem CID63462975
Molecular FormulaC15H14ClNO2
Molecular Weight275.74 g/mol
Exact Mass275.07
IUPAC Name6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid
SMILESCC1CCc2nc3cc(Cl)ccc3c(C(=O)O)c2C1
InChIInChI=1S/C15H14ClNO2/c1-8-2-5-12-11(6-8)14(15(18)19)10-4-3-9(16)7-13(10)17-12/h3-4,7-8H,2,5-6H2,1H3,(H,18,19)
InChIKeyJVTDIHFKJXLYGX-UHFFFAOYSA-N
XLogP3.71
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.74
LogP ≤ 53.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid?
The IUPAC name of 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid (CID 63462975) is 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid.
What is the SMILES notation for 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid?
The canonical SMILES for 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid is CC1CCc2nc3cc(Cl)ccc3c(C(=O)O)c2C1.
What is the InChIKey of 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid?
The InChIKey is JVTDIHFKJXLYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO2/c1-8-2-5-12-11(6-8)14(15(18)19)10-4-3-9(16)7-13(10)17-12/h3-4,7-8H,2,5-6H2,1H3,(H,18,19).
What are the key properties of 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid?
6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid has a molecular weight of 275.74 g/mol, XLogP of 3.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid is sourced from PubChem (CID 63462975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).