C15H33N — CID 63498321
4-methyl-N,2-bis(2-methylpropyl)hexan-1-amine (PubChem CID 63498321) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is 4-methyl-N,2-bis(2-methylpropyl)hexan-1-amine.
| Compound Name | 4-methyl-N,2-bis(2-methylpropyl)hexan-1-amine |
|---|---|
| PubChem CID | 63498321 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 4-methyl-N,2-bis(2-methylpropyl)hexan-1-amine |
| SMILES | CCC(C)CC(CNCC(C)C)CC(C)C |
| InChI | InChI=1S/C15H33N/c1-7-14(6)9-15(8-12(2)3)11-16-10-13(4)5/h12-16H,7-11H2,1-6H3 |
| InChIKey | MFSJVPOGPVQBQE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |