C15H17F3N2 — CID 63512159
2-[(1-methylcyclohexyl)amino]-5-(trifluoromethyl)benzonitrile (PubChem CID 63512159) has the molecular formula C15H17F3N2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-[(1-methylcyclohexyl)amino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[(1-methylcyclohexyl)amino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 63512159 |
| Molecular Formula | C15H17F3N2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-[(1-methylcyclohexyl)amino]-5-(trifluoromethyl)benzonitrile |
| SMILES | CC1(Nc2ccc(C(F)(F)F)cc2C#N)CCCCC1 |
| InChI | InChI=1S/C15H17F3N2/c1-14(7-3-2-4-8-14)20-13-6-5-12(15(16,17)18)9-11(13)10-19/h5-6,9,20H,2-4,7-8H2,1H3 |
| InChIKey | JSQBIWNSHDIVAN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |