C16H17N3S2 — CID 63519732
2-(4-methylsulfanylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide (PubChem CID 63519732) has the molecular formula C16H17N3S2 and a molecular weight of 315.47 g/mol. Its IUPAC name is 2-(4-methylsulfanylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide.
| Compound Name | 2-(4-methylsulfanylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 63519732 |
| Molecular Formula | C16H17N3S2 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-(4-methylsulfanylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
| SMILES | CSc1ccc(Nc2nc3c(cc2C(N)=S)CCC3)cc1 |
| InChI | InChI=1S/C16H17N3S2/c1-21-12-7-5-11(6-8-12)18-16-13(15(17)20)9-10-3-2-4-14(10)19-16/h5-9H,2-4H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | YPALNXBOJKSSIC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|