C17H19N3S — CID 63518872
2-(3-ethylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide (PubChem CID 63518872) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-(3-ethylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide.
| Compound Name | 2-(3-ethylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 63518872 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(3-ethylanilino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
| SMILES | CCc1cccc(Nc2nc3c(cc2C(N)=S)CCC3)c1 |
| InChI | InChI=1S/C17H19N3S/c1-2-11-5-3-7-13(9-11)19-17-14(16(18)21)10-12-6-4-8-15(12)20-17/h3,5,7,9-10H,2,4,6,8H2,1H3,(H2,18,21)(H,19,20) |
| InChIKey | VOXGUZKNCZYPFN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|