C20H16Cl4O4 — CID 635255
4,5,6,7-tetrachloro-1,2,9,16-tetramethoxypentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3(8),4,6,10,12,14-hexaene (PubChem CID 635255) has the molecular formula C20H16Cl4O4 and a molecular weight of 462.16 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-1,2,9,16-tetramethoxypentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3(8),4,6,10,12,14-hexaene.
| Compound Name | 4,5,6,7-tetrachloro-1,2,9,16-tetramethoxypentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3(8),4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 635255 |
| Molecular Formula | C20H16Cl4O4 |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | 4,5,6,7-tetrachloro-1,2,9,16-tetramethoxypentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3(8),4,6,10,12,14-hexaene |
| SMILES | COC12c3ccccc3C3(OC)C(OC)(c4c(Cl)c(Cl)c(Cl)c(Cl)c41)C23OC |
| InChI | InChI=1S/C20H16Cl4O4/c1-25-17-9-7-5-6-8-10(9)18(26-2)19(27-3,20(17,18)28-4)12-11(17)13(21)15(23)16(24)14(12)22/h5-8H,1-4H3 |
| InChIKey | AGSCXOHBOKWVIJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|