C11H5Cl3F3N — CID 63531524
2,8-dichloro-3-(chloromethyl)-5-(trifluoromethyl)quinoline (PubChem CID 63531524) has the molecular formula C11H5Cl3F3N and a molecular weight of 314.52 g/mol. Its IUPAC name is 2,8-dichloro-3-(chloromethyl)-5-(trifluoromethyl)quinoline.
| Compound Name | 2,8-dichloro-3-(chloromethyl)-5-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 63531524 |
| Molecular Formula | C11H5Cl3F3N |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | 2,8-dichloro-3-(chloromethyl)-5-(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1ccc(Cl)c2nc(Cl)c(CCl)cc12 |
| InChI | InChI=1S/C11H5Cl3F3N/c12-4-5-3-6-7(11(15,16)17)1-2-8(13)9(6)18-10(5)14/h1-3H,4H2 |
| InChIKey | BHTQMUDGSNIPOW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|