C12H12Cl2N2 — CID 63531730
5,7-dichloro-3-ethyl-N-methylquinolin-2-amine (PubChem CID 63531730) has the molecular formula C12H12Cl2N2 and a molecular weight of 255.15 g/mol. Its IUPAC name is 5,7-dichloro-3-ethyl-N-methylquinolin-2-amine.
| Compound Name | 5,7-dichloro-3-ethyl-N-methylquinolin-2-amine |
|---|---|
| PubChem CID | 63531730 |
| Molecular Formula | C12H12Cl2N2 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5,7-dichloro-3-ethyl-N-methylquinolin-2-amine |
| SMILES | CCc1cc2c(Cl)cc(Cl)cc2nc1NC |
| InChI | InChI=1S/C12H12Cl2N2/c1-3-7-4-9-10(14)5-8(13)6-11(9)16-12(7)15-2/h4-6H,3H2,1-2H3,(H,15,16) |
| InChIKey | PMOAFUMCPUVCNP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |