C10H12N4S — CID 63537729
3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]aniline (PubChem CID 63537729) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]aniline.
| Compound Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 63537729 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]aniline |
| SMILES | Cc1nnc(Sc2cccc(N)c2)n1C |
| InChI | InChI=1S/C10H12N4S/c1-7-12-13-10(14(7)2)15-9-5-3-4-8(11)6-9/h3-6H,11H2,1-2H3 |
| InChIKey | WQTNCVRRKXBWNY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|