C12H15N3O8 — CID 6353983
2-[(1R,5S)-7-methoxycarbonyl-1,5-dinitro-3-azabicyclo[3.3.1]non-6-en-3-yl]acetic acid (PubChem CID 6353983) has the molecular formula C12H15N3O8 and a molecular weight of 329.27 g/mol. Its IUPAC name is 2-[(1R,5S)-7-methoxycarbonyl-1,5-dinitro-3-azabicyclo[3.3.1]non-6-en-3-yl]acetic acid.
| Compound Name | 2-[(1R,5S)-7-methoxycarbonyl-1,5-dinitro-3-azabicyclo[3.3.1]non-6-en-3-yl]acetic acid |
|---|---|
| PubChem CID | 6353983 |
| Molecular Formula | C12H15N3O8 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[(1R,5S)-7-methoxycarbonyl-1,5-dinitro-3-azabicyclo[3.3.1]non-6-en-3-yl]acetic acid |
| SMILES | COC(=O)C1=C[C@]2([N+](=O)[O-])CN(CC(=O)O)C[C@@]([N+](=O)[O-])(C1)C2 |
| InChI | InChI=1S/C12H15N3O8/c1-23-10(18)8-2-11(14(19)20)5-12(3-8,15(21)22)7-13(6-11)4-9(16)17/h2H,3-7H2,1H3,(H,16,17)/t11-,12-/m1/s1 |
| InChIKey | QZOXTAZLLLZYAE-VXGBXAGGSA-N |
| XLogP | -0.69 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|