C12H19N3O7 — CID 4307786
2-(1,5-dinitro-3-azabicyclo[3.3.1]non-6-en-3-yl)-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 4307786) has the molecular formula C12H19N3O7 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-(1,5-dinitro-3-azabicyclo[3.3.1]non-6-en-3-yl)-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-(1,5-dinitro-3-azabicyclo[3.3.1]non-6-en-3-yl)-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 4307786 |
| Molecular Formula | C12H19N3O7 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-(1,5-dinitro-3-azabicyclo[3.3.1]non-6-en-3-yl)-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])C12C=CCC([N+](=O)[O-])(CN(C(CO)(CO)CO)C1)C2 |
| InChI | InChI=1S/C12H19N3O7/c16-7-12(8-17,9-18)13-5-10(14(19)20)2-1-3-11(4-10,6-13)15(21)22/h1-2,16-18H,3-9H2 |
| InChIKey | MBLCNFKZSXNSTQ-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|