C10H18N2O5 — CID 58251878
[6,7-bis(hydroxymethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanol (PubChem CID 58251878) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is [6,7-bis(hydroxymethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanol.
| Compound Name | [6,7-bis(hydroxymethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanol |
|---|---|
| PubChem CID | 58251878 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | [6,7-bis(hydroxymethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| SMILES | O=[N+]([O-])C12CC(CO)N(C(CO)C1)C(CO)C2 |
| InChI | InChI=1S/C10H18N2O5/c13-4-7-1-10(12(16)17)2-8(5-14)11(7)9(3-10)6-15/h7-9,13-15H,1-6H2 |
| InChIKey | KLQFRAUJKWSXKM-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|