C10H15N3O4 — CID 134984736
N-[(5S,7R)-3-nitro-1-adamantyl]nitramide (PubChem CID 134984736) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is N-[(5S,7R)-3-nitro-1-adamantyl]nitramide.
| Compound Name | N-[(5S,7R)-3-nitro-1-adamantyl]nitramide |
|---|---|
| PubChem CID | 134984736 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-[(5S,7R)-3-nitro-1-adamantyl]nitramide |
| SMILES | O=[N+]([O-])NC12C[C@H]3C[C@@H](C1)CC([N+](=O)[O-])(C3)C2 |
| InChI | InChI=1S/C10H15N3O4/c14-12(15)10-4-7-1-8(5-10)3-9(2-7,6-10)11-13(16)17/h7-8,11H,1-6H2/t7-,8+,9?,10? |
| InChIKey | YICYLPGHGPTKND-BQKDNTBBSA-N |
| XLogP | 1.14 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|