C18H33NO2 — CID 63542015
(5-methyl-2-propan-2-ylcyclohexyl) 1-amino-3-methylcyclohexane-1-carboxylate (PubChem CID 63542015) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 1-amino-3-methylcyclohexane-1-carboxylate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 1-amino-3-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 63542015 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 1-amino-3-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C2(N)CCCC(C)C2)C1 |
| InChI | InChI=1S/C18H33NO2/c1-12(2)15-8-7-13(3)10-16(15)21-17(20)18(19)9-5-6-14(4)11-18/h12-16H,5-11,19H2,1-4H3 |
| InChIKey | IFINNAZJAZXRRV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |