C17H17ClF2O — CID 63542173
2-[2-chloro-2-[3-(difluoromethoxy)phenyl]ethyl]-1,4-dimethylbenzene (PubChem CID 63542173) has the molecular formula C17H17ClF2O and a molecular weight of 310.77 g/mol. Its IUPAC name is 2-[2-chloro-2-[3-(difluoromethoxy)phenyl]ethyl]-1,4-dimethylbenzene.
| Compound Name | 2-[2-chloro-2-[3-(difluoromethoxy)phenyl]ethyl]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 63542173 |
| Molecular Formula | C17H17ClF2O |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[2-chloro-2-[3-(difluoromethoxy)phenyl]ethyl]-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(CC(Cl)c2cccc(OC(F)F)c2)c1 |
| InChI | InChI=1S/C17H17ClF2O/c1-11-6-7-12(2)14(8-11)10-16(18)13-4-3-5-15(9-13)21-17(19)20/h3-9,16-17H,10H2,1-2H3 |
| InChIKey | QGMHVWTWUHRFGD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|