C11H19N3 — CID 63550016
2-(4,6-dimethylpyrimidin-2-yl)pentan-3-amine (PubChem CID 63550016) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)pentan-3-amine.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)pentan-3-amine |
|---|---|
| PubChem CID | 63550016 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)pentan-3-amine |
| SMILES | CCC(N)C(C)c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C11H19N3/c1-5-10(12)9(4)11-13-7(2)6-8(3)14-11/h6,9-10H,5,12H2,1-4H3 |
| InChIKey | CALIOTPURFRXQR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |