C8H11ClN2 — CID 80655731
2-(1-chloroethyl)-4,6-dimethylpyrimidine (PubChem CID 80655731) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 2-(1-chloroethyl)-4,6-dimethylpyrimidine.
| Compound Name | 2-(1-chloroethyl)-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 80655731 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-(1-chloroethyl)-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(C(C)Cl)n1 |
| InChI | InChI=1S/C8H11ClN2/c1-5-4-6(2)11-8(10-5)7(3)9/h4,7H,1-3H3 |
| InChIKey | FEMXAWDCTROMQV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|