C6H9N2P — CID 177203756
(4,6-dimethylpyrimidin-2-yl)phosphane (PubChem CID 177203756) has the molecular formula C6H9N2P and a molecular weight of 140.13 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-2-yl)phosphane.
| Compound Name | (4,6-dimethylpyrimidin-2-yl)phosphane |
|---|---|
| PubChem CID | 177203756 |
| Molecular Formula | C6H9N2P |
| Molecular Weight | 140.13 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | (4,6-dimethylpyrimidin-2-yl)phosphane |
| SMILES | Cc1cc(C)nc(P)n1 |
| InChI | InChI=1S/C6H9N2P/c1-4-3-5(2)8-6(9)7-4/h3H,9H2,1-2H3 |
| InChIKey | JXQDOYXCDIRQPQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.13 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|