About (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine
(2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine (PubChem CID 96570656) has the molecular formula C10H17N3S
and a molecular weight of 211.33 g/mol. Its IUPAC name is (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine.
Molecular Properties
| Compound Name | (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine |
| PubChem CID | 96570656 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine |
| SMILES | CC[C@@H](N)CSc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C10H17N3S/c1-4-9(11)6-14-10-12-7(2)5-8(3)13-10/h5,9H,4,6,11H2,1-3H3/t9-/m1/s1 |
| InChIKey | IIHLYJYPTWDWSY-SECBINFHSA-N |
| XLogP | 1.92 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine?
The IUPAC name of (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine (CID 96570656) is (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine.
What is the SMILES notation for (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine?
The canonical SMILES for (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine is CC[C@@H](N)CSc1nc(C)cc(C)n1.
What is the InChIKey of (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine?
The InChIKey is IIHLYJYPTWDWSY-SECBINFHSA-N. The full InChI is InChI=1S/C10H17N3S/c1-4-9(11)6-14-10-12-7(2)5-8(3)13-10/h5,9H,4,6,11H2,1-3H3/t9-/m1/s1.
What are the key properties of (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine?
(2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine has a molecular weight of 211.33 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-2-amine is sourced from PubChem (CID 96570656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).